C19H16Cl2N2O5S — CID 69160196
2-[3-chloro-5-(3-chloro-5-cyanophenoxy)phenoxy]-N-(2,2-dihydroxythiolan-3-yl)acetamide (PubChem CID 69160196) has the molecular formula C19H16Cl2N2O5S and a molecular weight of 455.32 g/mol. Its IUPAC name is 2-[3-chloro-5-(3-chloro-5-cyanophenoxy)phenoxy]-N-(2,2-dihydroxythiolan-3-yl)acetamide.
| Compound Name | 2-[3-chloro-5-(3-chloro-5-cyanophenoxy)phenoxy]-N-(2,2-dihydroxythiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 69160196 |
| Molecular Formula | C19H16Cl2N2O5S |
| Molecular Weight | 455.32 g/mol |
| Exact Mass | 454.02 |
| IUPAC Name | 2-[3-chloro-5-(3-chloro-5-cyanophenoxy)phenoxy]-N-(2,2-dihydroxythiolan-3-yl)acetamide |
| SMILES | N#Cc1cc(Cl)cc(Oc2cc(Cl)cc(OCC(=O)NC3CCSC3(O)O)c2)c1 |
| InChI | InChI=1S/C19H16Cl2N2O5S/c20-12-3-11(9-22)4-15(6-12)28-16-7-13(21)5-14(8-16)27-10-18(24)23-17-1-2-29-19(17,25)26/h3-8,17,25-26H,1-2,10H2,(H,23,24) |
| InChIKey | JRMBYBGEMJKQKQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 111.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.32 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|