C19H21BrClN3O3 — CID 69160553
1-[(4-bromophenyl)methyl]-3-[(3-chloro-4-propan-2-yloxybenzoyl)amino]-1-methylurea (PubChem CID 69160553) has the molecular formula C19H21BrClN3O3 and a molecular weight of 454.75 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-3-[(3-chloro-4-propan-2-yloxybenzoyl)amino]-1-methylurea.
| Compound Name | 1-[(4-bromophenyl)methyl]-3-[(3-chloro-4-propan-2-yloxybenzoyl)amino]-1-methylurea |
|---|---|
| PubChem CID | 69160553 |
| Molecular Formula | C19H21BrClN3O3 |
| Molecular Weight | 454.75 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-3-[(3-chloro-4-propan-2-yloxybenzoyl)amino]-1-methylurea |
| SMILES | CC(C)Oc1ccc(C(=O)NNC(=O)N(C)Cc2ccc(Br)cc2)cc1Cl |
| InChI | InChI=1S/C19H21BrClN3O3/c1-12(2)27-17-9-6-14(10-16(17)21)18(25)22-23-19(26)24(3)11-13-4-7-15(20)8-5-13/h4-10,12H,11H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | JLQSEHITDBFTDO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.75 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|