C26H28Cl2N4O2 — CID 69163457
3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2H-chromeno[4,3-c]pyrazole-3-carboxamide (PubChem CID 69163457) has the molecular formula C26H28Cl2N4O2 and a molecular weight of 499.44 g/mol. Its IUPAC name is 3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2H-chromeno[4,3-c]pyrazole-3-carboxamide.
| Compound Name | 3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2H-chromeno[4,3-c]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 69163457 |
| Molecular Formula | C26H28Cl2N4O2 |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 3-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2H-chromeno[4,3-c]pyrazole-3-carboxamide |
| SMILES | CC1(C)Oc2ccccc2C2=C1C(C(N)=O)(N1CC3CCCC3C1)NN2c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H28Cl2N4O2/c1-25(2)23-22(18-8-3-4-9-21(18)34-25)32(20-11-10-17(27)12-19(20)28)30-26(23,24(29)33)31-13-15-6-5-7-16(15)14-31/h3-4,8-12,15-16,30H,5-7,13-14H2,1-2H3,(H2,29,33) |
| InChIKey | NVXGBTYNRHIZFR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |