C26H26Cl2N4O2 — CID 24967573
N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-1-(2,4-dichlorophenyl)-4,4-dimethylchromeno[3,4-d]pyrazole-3-carboxamide (PubChem CID 24967573) has the molecular formula C26H26Cl2N4O2 and a molecular weight of 497.43 g/mol. Its IUPAC name is N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-1-(2,4-dichlorophenyl)-4,4-dimethylchromeno[3,4-d]pyrazole-3-carboxamide.
| Compound Name | N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-1-(2,4-dichlorophenyl)-4,4-dimethylchromeno[3,4-d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 24967573 |
| Molecular Formula | C26H26Cl2N4O2 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-1-(2,4-dichlorophenyl)-4,4-dimethylchromeno[3,4-d]pyrazole-3-carboxamide |
| SMILES | CC1(C)Oc2ccccc2-c2c1c(C(=O)NN1CC3CCCC3C1)nn2-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H26Cl2N4O2/c1-26(2)22-23(25(33)30-31-13-15-6-5-7-16(15)14-31)29-32(20-11-10-17(27)12-19(20)28)24(22)18-8-3-4-9-21(18)34-26/h3-4,8-12,15-16H,5-7,13-14H2,1-2H3,(H,30,33) |
| InChIKey | MDOCZBGGJQGKIZ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |