C25H23Cl3F2N4O3 — CID 69187221
N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-1-(2,4-dichlorophenyl)-7-(difluoromethoxy)-4H-chromeno[3,4-d]pyrazole-3-carboxamide;hydrochloride (PubChem CID 69187221) has the molecular formula C25H23Cl3F2N4O3 and a molecular weight of 571.84 g/mol. Its IUPAC name is N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-1-(2,4-dichlorophenyl)-7-(difluoromethoxy)-4H-chromeno[3,4-d]pyrazole-3-carboxamide;hydrochloride.
| Compound Name | N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-1-(2,4-dichlorophenyl)-7-(difluoromethoxy)-4H-chromeno[3,4-d]pyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 69187221 |
| Molecular Formula | C25H23Cl3F2N4O3 |
| Molecular Weight | 571.84 g/mol |
| Exact Mass | 570.08 |
| IUPAC Name | N-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl)-1-(2,4-dichlorophenyl)-7-(difluoromethoxy)-4H-chromeno[3,4-d]pyrazole-3-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NN1CC2CCCC2C1)c1nn(-c2ccc(Cl)cc2Cl)c2c1COc1cc(OC(F)F)ccc1-2 |
| InChI | InChI=1S/C25H22Cl2F2N4O3.ClH/c26-15-4-7-20(19(27)8-15)33-23-17-6-5-16(36-25(28)29)9-21(17)35-12-18(23)22(30-33)24(34)31-32-10-13-2-1-3-14(13)11-32;/h4-9,13-14,25H,1-3,10-12H2,(H,31,34);1H |
| InChIKey | IKYIJUMMVLHQBI-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.84 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |