C8H15N3O3 — CID 69164457
(2-amino-2-oxo-1-piperidin-4-ylethyl)carbamic acid (PubChem CID 69164457) has the molecular formula C8H15N3O3 and a molecular weight of 201.23 g/mol. Its IUPAC name is (2-amino-2-oxo-1-piperidin-4-ylethyl)carbamic acid.
| Compound Name | (2-amino-2-oxo-1-piperidin-4-ylethyl)carbamic acid |
|---|---|
| PubChem CID | 69164457 |
| Molecular Formula | C8H15N3O3 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | (2-amino-2-oxo-1-piperidin-4-ylethyl)carbamic acid |
| SMILES | NC(=O)C(NC(=O)O)C1CCNCC1 |
| InChI | InChI=1S/C8H15N3O3/c9-7(12)6(11-8(13)14)5-1-3-10-4-2-5/h5-6,10-11H,1-4H2,(H2,9,12)(H,13,14) |
| InChIKey | SLOUMRYYETXEEB-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |