C19H19FN4O — CID 69164601
2-(3-fluorophenyl)-2-[[2-(4-methylanilino)pyrimidin-4-yl]amino]ethanol (PubChem CID 69164601) has the molecular formula C19H19FN4O and a molecular weight of 338.39 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-2-[[2-(4-methylanilino)pyrimidin-4-yl]amino]ethanol.
| Compound Name | 2-(3-fluorophenyl)-2-[[2-(4-methylanilino)pyrimidin-4-yl]amino]ethanol |
|---|---|
| PubChem CID | 69164601 |
| Molecular Formula | C19H19FN4O |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2-(3-fluorophenyl)-2-[[2-(4-methylanilino)pyrimidin-4-yl]amino]ethanol |
| SMILES | Cc1ccc(Nc2nccc(NC(CO)c3cccc(F)c3)n2)cc1 |
| InChI | InChI=1S/C19H19FN4O/c1-13-5-7-16(8-6-13)22-19-21-10-9-18(24-19)23-17(12-25)14-3-2-4-15(20)11-14/h2-11,17,25H,12H2,1H3,(H2,21,22,23,24) |
| InChIKey | MHJOYYQTRREYRA-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |