C27H46O2 — CID 69167455
(6R,10R,11R,14R,15R,23R)-6,10,15,19,19-pentamethyl-20-oxapentacyclo[9.9.3.01,6.07,23.010,14]tricosan-18-ol (PubChem CID 69167455) has the molecular formula C27H46O2 and a molecular weight of 402.66 g/mol. Its IUPAC name is (6R,10R,11R,14R,15R,23R)-6,10,15,19,19-pentamethyl-20-oxapentacyclo[9.9.3.01,6.07,23.010,14]tricosan-18-ol.
| Compound Name | (6R,10R,11R,14R,15R,23R)-6,10,15,19,19-pentamethyl-20-oxapentacyclo[9.9.3.01,6.07,23.010,14]tricosan-18-ol |
|---|---|
| PubChem CID | 69167455 |
| Molecular Formula | C27H46O2 |
| Molecular Weight | 402.66 g/mol |
| Exact Mass | 402.35 |
| IUPAC Name | (6R,10R,11R,14R,15R,23R)-6,10,15,19,19-pentamethyl-20-oxapentacyclo[9.9.3.01,6.07,23.010,14]tricosan-18-ol |
| SMILES | C[C@@H]1CCC(O)C(C)(C)OC23CCCC[C@]2(C)C2CC[C@]4(C)[C@@H]1CC[C@@H]4[C@H]2CC3 |
| InChI | InChI=1S/C27H46O2/c1-18-8-11-23(28)24(2,3)29-27-15-7-6-14-26(27,5)22-13-16-25(4)20(18)9-10-21(25)19(22)12-17-27/h18-23,28H,6-17H2,1-5H3/t18-,19-,20-,21-,22?,23?,25-,26-,27?/m1/s1 |
| InChIKey | FGYZXIFRTUVWHX-OMDGSVBYSA-N |
| XLogP | 6.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.66 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |