C36H64O2 — CID 69168624
[(8R,9S,10S,13R,14S,17R)-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] octanoate (PubChem CID 69168624) has the molecular formula C36H64O2 and a molecular weight of 528.91 g/mol. Its IUPAC name is [(8R,9S,10S,13R,14S,17R)-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] octanoate.
| Compound Name | [(8R,9S,10S,13R,14S,17R)-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] octanoate |
|---|---|
| PubChem CID | 69168624 |
| Molecular Formula | C36H64O2 |
| Molecular Weight | 528.91 g/mol |
| Exact Mass | 528.49 |
| IUPAC Name | [(8R,9S,10S,13R,14S,17R)-17-[(2R,5S)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)OC1CC[C@@]2(C)C(CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CC[C@H](C)C(C)C)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C36H64O2/c1-8-9-10-11-12-13-34(37)38-29-20-22-35(6)28(24-29)16-17-30-32-19-18-31(36(32,7)23-21-33(30)35)27(5)15-14-26(4)25(2)3/h25-33H,8-24H2,1-7H3/t26-,27+,28?,29?,30-,31+,32-,33-,35-,36+/m0/s1 |
| InChIKey | CBZRGYGIJICAII-AUHGJTRYSA-N |
| XLogP | 10.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.91 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|