C35H62O2 — CID 68837509
[(8R,9S,10S,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] hexanoate (PubChem CID 68837509) has the molecular formula C35H62O2 and a molecular weight of 514.88 g/mol. Its IUPAC name is [(8R,9S,10S,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] hexanoate.
| Compound Name | [(8R,9S,10S,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] hexanoate |
|---|---|
| PubChem CID | 68837509 |
| Molecular Formula | C35H62O2 |
| Molecular Weight | 514.88 g/mol |
| Exact Mass | 514.47 |
| IUPAC Name | [(8R,9S,10S,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] hexanoate |
| SMILES | CCCCCC(=O)OC1CC[C@@]2(C)C(CC[C@H]3[C@@H]4CC[C@H]([C@H](C)CC[C@@H](CC)C(C)C)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C35H62O2/c1-8-10-11-12-33(36)37-28-19-21-34(6)27(23-28)15-16-29-31-18-17-30(35(31,7)22-20-32(29)34)25(5)13-14-26(9-2)24(3)4/h24-32H,8-23H2,1-7H3/t25-,26-,27?,28?,29+,30-,31+,32+,34+,35-/m1/s1 |
| InChIKey | OKJVAAILQDJKRW-GSXJQPGYSA-N |
| XLogP | 10.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.88 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|