C37H64O3 — CID 132573933
[(8R,9S,10S,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 8-oxooctanoate (PubChem CID 132573933) has the molecular formula C37H64O3 and a molecular weight of 556.92 g/mol. Its IUPAC name is [(8R,9S,10S,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 8-oxooctanoate.
| Compound Name | [(8R,9S,10S,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 8-oxooctanoate |
|---|---|
| PubChem CID | 132573933 |
| Molecular Formula | C37H64O3 |
| Molecular Weight | 556.92 g/mol |
| Exact Mass | 556.49 |
| IUPAC Name | [(8R,9S,10S,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] 8-oxooctanoate |
| SMILES | CC[C@H](CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4CC(OC(=O)CCCCCCC=O)CC[C@]4(C)[C@H]3CC[C@]12C)C(C)C |
| InChI | InChI=1S/C37H64O3/c1-7-28(26(2)3)15-14-27(4)32-18-19-33-31-17-16-29-25-30(40-35(39)13-11-9-8-10-12-24-38)20-22-36(29,5)34(31)21-23-37(32,33)6/h24,26-34H,7-23,25H2,1-6H3/t27-,28-,29?,30?,31+,32-,33+,34+,36+,37-/m1/s1 |
| InChIKey | AKUZTZZVWZDKEX-LWFCAVTLSA-N |
| XLogP | 10.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.92 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|