C23H38N2O2 — CID 69169794
N-(1-adamantyl)-3,3-dimethyl-5-(3-methylpiperidin-1-yl)-5-oxopentanamide (PubChem CID 69169794) has the molecular formula C23H38N2O2 and a molecular weight of 374.57 g/mol. Its IUPAC name is N-(1-adamantyl)-3,3-dimethyl-5-(3-methylpiperidin-1-yl)-5-oxopentanamide.
| Compound Name | N-(1-adamantyl)-3,3-dimethyl-5-(3-methylpiperidin-1-yl)-5-oxopentanamide |
|---|---|
| PubChem CID | 69169794 |
| Molecular Formula | C23H38N2O2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | N-(1-adamantyl)-3,3-dimethyl-5-(3-methylpiperidin-1-yl)-5-oxopentanamide |
| SMILES | CC1CCCN(C(=O)CC(C)(C)CC(=O)NC23CC4CC(CC(C4)C2)C3)C1 |
| InChI | InChI=1S/C23H38N2O2/c1-16-5-4-6-25(15-16)21(27)14-22(2,3)13-20(26)24-23-10-17-7-18(11-23)9-19(8-17)12-23/h16-19H,4-15H2,1-3H3,(H,24,26) |
| InChIKey | OAUSAJLXWZRIGU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |