C24H36N6O — CID 135771504
1-(1-adamantyl)-3-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-C-(3-methylpiperidin-1-yl)carbonimidoyl]urea (PubChem CID 135771504) has the molecular formula C24H36N6O and a molecular weight of 424.59 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-C-(3-methylpiperidin-1-yl)carbonimidoyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-C-(3-methylpiperidin-1-yl)carbonimidoyl]urea |
|---|---|
| PubChem CID | 135771504 |
| Molecular Formula | C24H36N6O |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | 1-(1-adamantyl)-3-[(Z)-N-(4,6-dimethylpyrimidin-2-yl)-C-(3-methylpiperidin-1-yl)carbonimidoyl]urea |
| SMILES | Cc1cc(C)nc(/N=C(/NC(=O)NC23CC4CC(CC(C4)C2)C3)N2CCCC(C)C2)n1 |
| InChI | InChI=1S/C24H36N6O/c1-15-5-4-6-30(14-15)22(27-21-25-16(2)7-17(3)26-21)28-23(31)29-24-11-18-8-19(12-24)10-20(9-18)13-24/h7,15,18-20H,4-6,8-14H2,1-3H3,(H2,25,26,27,28,29,31) |
| InChIKey | QMZBCYNIALKXAN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|