C23H28N4O4 — CID 69171278
tert-butyl 3-(4-amino-8,9-dimethoxybenzo[c][2,7]naphthyridin-2-yl)pyrrolidine-1-carboxylate (PubChem CID 69171278) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is tert-butyl 3-(4-amino-8,9-dimethoxybenzo[c][2,7]naphthyridin-2-yl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-amino-8,9-dimethoxybenzo[c][2,7]naphthyridin-2-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 69171278 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | tert-butyl 3-(4-amino-8,9-dimethoxybenzo[c][2,7]naphthyridin-2-yl)pyrrolidine-1-carboxylate |
| SMILES | COc1cc2ncc3c(N)nc(C4CCN(C(=O)OC(C)(C)C)C4)cc3c2cc1OC |
| InChI | InChI=1S/C23H28N4O4/c1-23(2,3)31-22(28)27-7-6-13(12-27)17-8-14-15-9-19(29-4)20(30-5)10-18(15)25-11-16(14)21(24)26-17/h8-11,13H,6-7,12H2,1-5H3,(H2,24,26) |
| InChIKey | UMPZHLBECOSMJF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 99.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|