About 1-(5-amino-1,3,4-thiadiazol-2-yl)piperidine-4-carboxylic acid
1-(5-amino-1,3,4-thiadiazol-2-yl)piperidine-4-carboxylic acid (PubChem CID 6917210) has the molecular formula C8H12N4O2S
and a molecular weight of 228.28 g/mol. Its IUPAC name is 1-(5-amino-1,3,4-thiadiazol-2-yl)piperidine-4-carboxylic acid.
Analyze 1-(5-amino-1,3,4-thiadiazol-2-yl)piperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-amino-1,3,4-thiadiazol-2-yl)piperidine-4-carboxylic acid?
The IUPAC name of 1-(5-amino-1,3,4-thiadiazol-2-yl)piperidine-4-carboxylic acid (CID 6917210) is 1-(5-amino-1,3,4-thiadiazol-2-yl)piperidine-4-carboxylic acid.
What is the SMILES notation for 1-(5-amino-1,3,4-thiadiazol-2-yl)piperidine-4-carboxylic acid?
The canonical SMILES for 1-(5-amino-1,3,4-thiadiazol-2-yl)piperidine-4-carboxylic acid is Nc1nnc(N2CCC(C(=O)O)CC2)s1.
What is the InChIKey of 1-(5-amino-1,3,4-thiadiazol-2-yl)piperidine-4-carboxylic acid?
The InChIKey is JUCQFZVLBAATER-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O2S/c9-7-10-11-8(15-7)12-3-1-5(2-4-12)6(13)14/h5H,1-4H2,(H2,9,10)(H,13,14).
What are the key properties of 1-(5-amino-1,3,4-thiadiazol-2-yl)piperidine-4-carboxylic acid?
1-(5-amino-1,3,4-thiadiazol-2-yl)piperidine-4-carboxylic acid has a molecular weight of 228.28 g/mol, XLogP of 0.42, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-amino-1,3,4-thiadiazol-2-yl)piperidine-4-carboxylic acid is sourced from PubChem (CID 6917210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).