C28H32Cl2F3N3O6 — CID 69172803
2-[4-acetyloxy-2-chloro-5-[3-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]-4-hydroxypyrrolidin-1-yl]phenoxy]ethyl 2,2,2-trifluoroacetate (PubChem CID 69172803) has the molecular formula C28H32Cl2F3N3O6 and a molecular weight of 634.48 g/mol. Its IUPAC name is 2-[4-acetyloxy-2-chloro-5-[3-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]-4-hydroxypyrrolidin-1-yl]phenoxy]ethyl 2,2,2-trifluoroacetate.
| Compound Name | 2-[4-acetyloxy-2-chloro-5-[3-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]-4-hydroxypyrrolidin-1-yl]phenoxy]ethyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 69172803 |
| Molecular Formula | C28H32Cl2F3N3O6 |
| Molecular Weight | 634.48 g/mol |
| Exact Mass | 633.16 |
| IUPAC Name | 2-[4-acetyloxy-2-chloro-5-[3-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]-4-hydroxypyrrolidin-1-yl]phenoxy]ethyl 2,2,2-trifluoroacetate |
| SMILES | CC(=O)Oc1cc(Cl)c(OCCOC(=O)C(F)(F)F)cc1N1CC(O)C(NC2CCN(Cc3ccc(Cl)cc3)CC2)C1 |
| InChI | InChI=1S/C28H32Cl2F3N3O6/c1-17(37)42-26-12-21(30)25(40-10-11-41-27(39)28(31,32)33)13-23(26)36-15-22(24(38)16-36)34-20-6-8-35(9-7-20)14-18-2-4-19(29)5-3-18/h2-5,12-13,20,22,24,34,38H,6-11,14-16H2,1H3 |
| InChIKey | DTAROJGQLVFYKC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|