C26H33ClFN3O4 — CID 87722493
[2-[(3R,4R)-3-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]-4-hydroxypyrrolidin-1-yl]-3-ethyl-4-fluorophenyl] ethaneperoxoate (PubChem CID 87722493) has the molecular formula C26H33ClFN3O4 and a molecular weight of 506.02 g/mol. Its IUPAC name is [2-[(3R,4R)-3-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]-4-hydroxypyrrolidin-1-yl]-3-ethyl-4-fluorophenyl] ethaneperoxoate.
| Compound Name | [2-[(3R,4R)-3-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]-4-hydroxypyrrolidin-1-yl]-3-ethyl-4-fluorophenyl] ethaneperoxoate |
|---|---|
| PubChem CID | 87722493 |
| Molecular Formula | C26H33ClFN3O4 |
| Molecular Weight | 506.02 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | [2-[(3R,4R)-3-[[1-[(4-chlorophenyl)methyl]piperidin-4-yl]amino]-4-hydroxypyrrolidin-1-yl]-3-ethyl-4-fluorophenyl] ethaneperoxoate |
| SMILES | CCc1c(F)ccc(OOC(C)=O)c1N1C[C@@H](O)[C@H](NC2CCN(Cc3ccc(Cl)cc3)CC2)C1 |
| InChI | InChI=1S/C26H33ClFN3O4/c1-3-21-22(28)8-9-25(35-34-17(2)32)26(21)31-15-23(24(33)16-31)29-20-10-12-30(13-11-20)14-18-4-6-19(27)7-5-18/h4-9,20,23-24,29,33H,3,10-16H2,1-2H3/t23-,24-/m1/s1 |
| InChIKey | HQIGVNMQBBCODM-DNQXCXABSA-N |
| XLogP | 3.70 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.02 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|