C20H25NO5S — CID 69173374
methyl 3-(4-hydroxy-3-phenylbutyl)-5-[methyl(methylsulfonyl)amino]benzoate (PubChem CID 69173374) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is methyl 3-(4-hydroxy-3-phenylbutyl)-5-[methyl(methylsulfonyl)amino]benzoate.
| Compound Name | methyl 3-(4-hydroxy-3-phenylbutyl)-5-[methyl(methylsulfonyl)amino]benzoate |
|---|---|
| PubChem CID | 69173374 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | methyl 3-(4-hydroxy-3-phenylbutyl)-5-[methyl(methylsulfonyl)amino]benzoate |
| SMILES | COC(=O)c1cc(CCC(CO)c2ccccc2)cc(N(C)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C20H25NO5S/c1-21(27(3,24)25)19-12-15(11-18(13-19)20(23)26-2)9-10-17(14-22)16-7-5-4-6-8-16/h4-8,11-13,17,22H,9-10,14H2,1-3H3 |
| InChIKey | PWLXIYAIVQWGGC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |