C18H21BrO3S — CID 158197872
methyl 3-bromo-4-[(3S)-4-hydroxy-3-phenylbutyl]benzoate;sulfane (PubChem CID 158197872) has the molecular formula C18H21BrO3S and a molecular weight of 397.33 g/mol. Its IUPAC name is methyl 3-bromo-4-[(3S)-4-hydroxy-3-phenylbutyl]benzoate;sulfane.
| Compound Name | methyl 3-bromo-4-[(3S)-4-hydroxy-3-phenylbutyl]benzoate;sulfane |
|---|---|
| PubChem CID | 158197872 |
| Molecular Formula | C18H21BrO3S |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | methyl 3-bromo-4-[(3S)-4-hydroxy-3-phenylbutyl]benzoate;sulfane |
| SMILES | COC(=O)c1ccc(CC[C@H](CO)c2ccccc2)c(Br)c1.S |
| InChI | InChI=1S/C18H19BrO3.H2S/c1-22-18(21)15-9-7-14(17(19)11-15)8-10-16(12-20)13-5-3-2-4-6-13;/h2-7,9,11,16,20H,8,10,12H2,1H3;1H2/t16-;/m1./s1 |
| InChIKey | GAODXEIYKMERMD-PKLMIRHRSA-N |
| XLogP | 4.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |