C18H22BrNO3S — CID 159401826
methyl 3-bromo-4-[[[(1S)-2-hydroxy-1-(4-methylphenyl)ethyl]amino]methyl]benzoate;sulfane (PubChem CID 159401826) has the molecular formula C18H22BrNO3S and a molecular weight of 412.35 g/mol. Its IUPAC name is methyl 3-bromo-4-[[[(1S)-2-hydroxy-1-(4-methylphenyl)ethyl]amino]methyl]benzoate;sulfane.
| Compound Name | methyl 3-bromo-4-[[[(1S)-2-hydroxy-1-(4-methylphenyl)ethyl]amino]methyl]benzoate;sulfane |
|---|---|
| PubChem CID | 159401826 |
| Molecular Formula | C18H22BrNO3S |
| Molecular Weight | 412.35 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | methyl 3-bromo-4-[[[(1S)-2-hydroxy-1-(4-methylphenyl)ethyl]amino]methyl]benzoate;sulfane |
| SMILES | COC(=O)c1ccc(CN[C@H](CO)c2ccc(C)cc2)c(Br)c1.S |
| InChI | InChI=1S/C18H20BrNO3.H2S/c1-12-3-5-13(6-4-12)17(11-21)20-10-15-8-7-14(9-16(15)19)18(22)23-2;/h3-9,17,20-21H,10-11H2,1-2H3;1H2/t17-;/m1./s1 |
| InChIKey | LNKZPLCOXZYCKX-UNTBIKODSA-N |
| XLogP | 3.48 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |