C17H18BrNO3 — CID 122437680
3-bromo-4-[[[(1S)-2-hydroxy-1-(4-methylphenyl)ethyl]amino]methyl]benzoic acid (PubChem CID 122437680) has the molecular formula C17H18BrNO3 and a molecular weight of 364.24 g/mol. Its IUPAC name is 3-bromo-4-[[[(1S)-2-hydroxy-1-(4-methylphenyl)ethyl]amino]methyl]benzoic acid.
| Compound Name | 3-bromo-4-[[[(1S)-2-hydroxy-1-(4-methylphenyl)ethyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122437680 |
| Molecular Formula | C17H18BrNO3 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 3-bromo-4-[[[(1S)-2-hydroxy-1-(4-methylphenyl)ethyl]amino]methyl]benzoic acid |
| SMILES | Cc1ccc([C@@H](CO)NCc2ccc(C(=O)O)cc2Br)cc1 |
| InChI | InChI=1S/C17H18BrNO3/c1-11-2-4-12(5-3-11)16(10-20)19-9-14-7-6-13(17(21)22)8-15(14)18/h2-8,16,19-20H,9-10H2,1H3,(H,21,22)/t16-/m1/s1 |
| InChIKey | SALAOZONGDRJDU-MRXNPFEDSA-N |
| XLogP | 3.28 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |