C17H15BrF3NO3 — CID 122437712
3-bromo-4-[[[2-hydroxy-1-[4-(trifluoromethyl)phenyl]ethyl]amino]methyl]benzoic acid (PubChem CID 122437712) has the molecular formula C17H15BrF3NO3 and a molecular weight of 418.21 g/mol. Its IUPAC name is 3-bromo-4-[[[2-hydroxy-1-[4-(trifluoromethyl)phenyl]ethyl]amino]methyl]benzoic acid.
| Compound Name | 3-bromo-4-[[[2-hydroxy-1-[4-(trifluoromethyl)phenyl]ethyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122437712 |
| Molecular Formula | C17H15BrF3NO3 |
| Molecular Weight | 418.21 g/mol |
| Exact Mass | 417.02 |
| IUPAC Name | 3-bromo-4-[[[2-hydroxy-1-[4-(trifluoromethyl)phenyl]ethyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(CO)c2ccc(C(F)(F)F)cc2)c(Br)c1 |
| InChI | InChI=1S/C17H15BrF3NO3/c18-14-7-11(16(24)25)1-2-12(14)8-22-15(9-23)10-3-5-13(6-4-10)17(19,20)21/h1-7,15,22-23H,8-9H2,(H,24,25) |
| InChIKey | UBASBWZYMOYPBR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.21 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |