C18H17BrF3NO3 — CID 122439490
methyl 3-bromo-4-[[[2-hydroxy-1-[2-(trifluoromethyl)phenyl]ethyl]amino]methyl]benzoate (PubChem CID 122439490) has the molecular formula C18H17BrF3NO3 and a molecular weight of 432.24 g/mol. Its IUPAC name is methyl 3-bromo-4-[[[2-hydroxy-1-[2-(trifluoromethyl)phenyl]ethyl]amino]methyl]benzoate.
| Compound Name | methyl 3-bromo-4-[[[2-hydroxy-1-[2-(trifluoromethyl)phenyl]ethyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 122439490 |
| Molecular Formula | C18H17BrF3NO3 |
| Molecular Weight | 432.24 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | methyl 3-bromo-4-[[[2-hydroxy-1-[2-(trifluoromethyl)phenyl]ethyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(CO)c2ccccc2C(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C18H17BrF3NO3/c1-26-17(25)11-6-7-12(15(19)8-11)9-23-16(10-24)13-4-2-3-5-14(13)18(20,21)22/h2-8,16,23-24H,9-10H2,1H3 |
| InChIKey | XKGCLDWLJWGQKE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.24 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |