C14H20BrNO3 — CID 122467504
methyl 3-bromo-4-[[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]methyl]benzoate (PubChem CID 122467504) has the molecular formula C14H20BrNO3 and a molecular weight of 330.22 g/mol. Its IUPAC name is methyl 3-bromo-4-[[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]methyl]benzoate.
| Compound Name | methyl 3-bromo-4-[[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 122467504 |
| Molecular Formula | C14H20BrNO3 |
| Molecular Weight | 330.22 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | methyl 3-bromo-4-[[[(2S)-1-hydroxy-3-methylbutan-2-yl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN[C@H](CO)C(C)C)c(Br)c1 |
| InChI | InChI=1S/C14H20BrNO3/c1-9(2)13(8-17)16-7-11-5-4-10(6-12(11)15)14(18)19-3/h4-6,9,13,16-17H,7-8H2,1-3H3/t13-/m1/s1 |
| InChIKey | QXFBQASISVJCCP-CYBMUJFWSA-N |
| XLogP | 2.34 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.22 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |