C16H25BrN2O2 — CID 102766625
methyl 3-bromo-4-[[1-(diethylamino)propan-2-ylamino]methyl]benzoate (PubChem CID 102766625) has the molecular formula C16H25BrN2O2 and a molecular weight of 357.29 g/mol. Its IUPAC name is methyl 3-bromo-4-[[1-(diethylamino)propan-2-ylamino]methyl]benzoate.
| Compound Name | methyl 3-bromo-4-[[1-(diethylamino)propan-2-ylamino]methyl]benzoate |
|---|---|
| PubChem CID | 102766625 |
| Molecular Formula | C16H25BrN2O2 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | methyl 3-bromo-4-[[1-(diethylamino)propan-2-ylamino]methyl]benzoate |
| SMILES | CCN(CC)CC(C)NCc1ccc(C(=O)OC)cc1Br |
| InChI | InChI=1S/C16H25BrN2O2/c1-5-19(6-2)11-12(3)18-10-14-8-7-13(9-15(14)17)16(20)21-4/h7-9,12,18H,5-6,10-11H2,1-4H3 |
| InChIKey | CMMCVBHQGGHDPW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |