C16H16BrNO3 — CID 122437638
3-bromo-4-[[[(1S)-2-hydroxy-1-phenylethyl]amino]methyl]benzoic acid (PubChem CID 122437638) has the molecular formula C16H16BrNO3 and a molecular weight of 350.21 g/mol. Its IUPAC name is 3-bromo-4-[[[(1S)-2-hydroxy-1-phenylethyl]amino]methyl]benzoic acid.
| Compound Name | 3-bromo-4-[[[(1S)-2-hydroxy-1-phenylethyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122437638 |
| Molecular Formula | C16H16BrNO3 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 3-bromo-4-[[[(1S)-2-hydroxy-1-phenylethyl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN[C@H](CO)c2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C16H16BrNO3/c17-14-8-12(16(20)21)6-7-13(14)9-18-15(10-19)11-4-2-1-3-5-11/h1-8,15,18-19H,9-10H2,(H,20,21)/t15-/m1/s1 |
| InChIKey | KNKZPDPMOQQSPR-OAHLLOKOSA-N |
| XLogP | 2.97 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |