C51H64F2N4O5 — CID 69173460
bis[1-[4-(dimethylamino)butyl]-4-(3-fluoro-2-methylphenyl)-5-(3-hydroxybenzoyl)piperidin-3-yl]methanone (PubChem CID 69173460) has the molecular formula C51H64F2N4O5 and a molecular weight of 851.09 g/mol. Its IUPAC name is bis[1-[4-(dimethylamino)butyl]-4-(3-fluoro-2-methylphenyl)-5-(3-hydroxybenzoyl)piperidin-3-yl]methanone.
| Compound Name | bis[1-[4-(dimethylamino)butyl]-4-(3-fluoro-2-methylphenyl)-5-(3-hydroxybenzoyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 69173460 |
| Molecular Formula | C51H64F2N4O5 |
| Molecular Weight | 851.09 g/mol |
| Exact Mass | 850.48 |
| IUPAC Name | bis[1-[4-(dimethylamino)butyl]-4-(3-fluoro-2-methylphenyl)-5-(3-hydroxybenzoyl)piperidin-3-yl]methanone |
| SMILES | Cc1c(F)cccc1C1C(C(=O)c2cccc(O)c2)CN(CCCCN(C)C)CC1C(=O)C1CN(CCCCN(C)C)CC(C(=O)c2cccc(O)c2)C1c1cccc(F)c1C |
| InChI | InChI=1S/C51H64F2N4O5/c1-33-39(19-13-21-45(33)52)47-41(49(60)35-15-11-17-37(58)27-35)29-56(25-9-7-23-54(3)4)31-43(47)51(62)44-32-57(26-10-8-24-55(5)6)30-42(50(61)36-16-12-18-38(59)28-36)48(44)40-20-14-22-46(53)34(40)2/h11-22,27-28,41-44,47-48,58-59H,7-10,23-26,29-32H2,1-6H3 |
| InChIKey | RYYQSTRREKKPOW-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.09 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|