C57H76F2N4O5 — CID 87723086
bis[1-[(3S)-3-(dimethylamino)-4,4-dimethylpentyl]-4-(3-fluoro-2-methylphenyl)-5-(3-hydroxybenzoyl)piperidin-3-yl]methanone (PubChem CID 87723086) has the molecular formula C57H76F2N4O5 and a molecular weight of 935.25 g/mol. Its IUPAC name is bis[1-[(3S)-3-(dimethylamino)-4,4-dimethylpentyl]-4-(3-fluoro-2-methylphenyl)-5-(3-hydroxybenzoyl)piperidin-3-yl]methanone.
| Compound Name | bis[1-[(3S)-3-(dimethylamino)-4,4-dimethylpentyl]-4-(3-fluoro-2-methylphenyl)-5-(3-hydroxybenzoyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 87723086 |
| Molecular Formula | C57H76F2N4O5 |
| Molecular Weight | 935.25 g/mol |
| Exact Mass | 934.58 |
| IUPAC Name | bis[1-[(3S)-3-(dimethylamino)-4,4-dimethylpentyl]-4-(3-fluoro-2-methylphenyl)-5-(3-hydroxybenzoyl)piperidin-3-yl]methanone |
| SMILES | Cc1c(F)cccc1C1C(C(=O)c2cccc(O)c2)CN(CC[C@H](N(C)C)C(C)(C)C)CC1C(=O)C1CN(CC[C@H](N(C)C)C(C)(C)C)CC(C(=O)c2cccc(O)c2)C1c1cccc(F)c1C |
| InChI | InChI=1S/C57H76F2N4O5/c1-35-41(21-15-23-47(35)58)51-43(53(66)37-17-13-19-39(64)29-37)31-62(27-25-49(60(9)10)56(3,4)5)33-45(51)55(68)46-34-63(28-26-50(61(11)12)57(6,7)8)32-44(54(67)38-18-14-20-40(65)30-38)52(46)42-22-16-24-48(59)36(42)2/h13-24,29-30,43-46,49-52,64-65H,25-28,31-34H2,1-12H3/t43?,44?,45?,46?,49-,50-,51?,52?/m0/s1 |
| InChIKey | GBLCBVVINDTVJF-OGPTWRFJSA-N |
| XLogP | 10.02 |
| TPSA | 104.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 935.25 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |