About 4-piperazin-1-yl-1H-1,8-naphthyridin-2-one
4-piperazin-1-yl-1H-1,8-naphthyridin-2-one (PubChem CID 69174819) has the molecular formula C12H14N4O
and a molecular weight of 230.27 g/mol. Its IUPAC name is 4-piperazin-1-yl-1H-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 4-piperazin-1-yl-1H-1,8-naphthyridin-2-one |
| PubChem CID | 69174819 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 4-piperazin-1-yl-1H-1,8-naphthyridin-2-one |
| SMILES | O=c1cc(N2CCNCC2)c2cccnc2[nH]1 |
| InChI | InChI=1S/C12H14N4O/c17-11-8-10(16-6-4-13-5-7-16)9-2-1-3-14-12(9)15-11/h1-3,8,13H,4-7H2,(H,14,15,17) |
| InChIKey | KRSDTPCLDUBMLX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-piperazin-1-yl-1H-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperazin-1-yl-1H-1,8-naphthyridin-2-one?
The IUPAC name of 4-piperazin-1-yl-1H-1,8-naphthyridin-2-one (CID 69174819) is 4-piperazin-1-yl-1H-1,8-naphthyridin-2-one.
What is the SMILES notation for 4-piperazin-1-yl-1H-1,8-naphthyridin-2-one?
The canonical SMILES for 4-piperazin-1-yl-1H-1,8-naphthyridin-2-one is O=c1cc(N2CCNCC2)c2cccnc2[nH]1.
What is the InChIKey of 4-piperazin-1-yl-1H-1,8-naphthyridin-2-one?
The InChIKey is KRSDTPCLDUBMLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O/c17-11-8-10(16-6-4-13-5-7-16)9-2-1-3-14-12(9)15-11/h1-3,8,13H,4-7H2,(H,14,15,17).
What are the key properties of 4-piperazin-1-yl-1H-1,8-naphthyridin-2-one?
4-piperazin-1-yl-1H-1,8-naphthyridin-2-one has a molecular weight of 230.27 g/mol, XLogP of 0.33, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperazin-1-yl-1H-1,8-naphthyridin-2-one is sourced from PubChem (CID 69174819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).