C12H14N4 — CID 57013367
4-piperazin-1-yl-1,5-naphthyridine (PubChem CID 57013367) has the molecular formula C12H14N4 and a molecular weight of 214.27 g/mol. Its IUPAC name is 4-piperazin-1-yl-1,5-naphthyridine.
| Compound Name | 4-piperazin-1-yl-1,5-naphthyridine |
|---|---|
| PubChem CID | 57013367 |
| Molecular Formula | C12H14N4 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 4-piperazin-1-yl-1,5-naphthyridine |
| SMILES | c1cnc2c(N3CCNCC3)ccnc2c1 |
| InChI | InChI=1S/C12H14N4/c1-2-10-12(15-4-1)11(3-5-14-10)16-8-6-13-7-9-16/h1-5,13H,6-9H2 |
| InChIKey | SDOWEKDPLKKXGU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |