About 7-piperazin-1-ylthieno[3,2-b]pyridine
7-piperazin-1-ylthieno[3,2-b]pyridine (PubChem CID 67539796) has the molecular formula C11H13N3S
and a molecular weight of 219.31 g/mol. Its IUPAC name is 7-piperazin-1-ylthieno[3,2-b]pyridine.
Molecular Properties
| Compound Name | 7-piperazin-1-ylthieno[3,2-b]pyridine |
| PubChem CID | 67539796 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 7-piperazin-1-ylthieno[3,2-b]pyridine |
| SMILES | c1cc(N2CCNCC2)c2sccc2n1 |
| InChI | InChI=1S/C11H13N3S/c1-3-13-9-2-8-15-11(9)10(1)14-6-4-12-5-7-14/h1-3,8,12H,4-7H2 |
| InChIKey | VTNFLAXAYXFTFH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-piperazin-1-ylthieno[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-piperazin-1-ylthieno[3,2-b]pyridine?
The IUPAC name of 7-piperazin-1-ylthieno[3,2-b]pyridine (CID 67539796) is 7-piperazin-1-ylthieno[3,2-b]pyridine.
What is the SMILES notation for 7-piperazin-1-ylthieno[3,2-b]pyridine?
The canonical SMILES for 7-piperazin-1-ylthieno[3,2-b]pyridine is c1cc(N2CCNCC2)c2sccc2n1.
What is the InChIKey of 7-piperazin-1-ylthieno[3,2-b]pyridine?
The InChIKey is VTNFLAXAYXFTFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3S/c1-3-13-9-2-8-15-11(9)10(1)14-6-4-12-5-7-14/h1-3,8,12H,4-7H2.
What are the key properties of 7-piperazin-1-ylthieno[3,2-b]pyridine?
7-piperazin-1-ylthieno[3,2-b]pyridine has a molecular weight of 219.31 g/mol, XLogP of 1.71, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-piperazin-1-ylthieno[3,2-b]pyridine is sourced from PubChem (CID 67539796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).