C19H19FN2OS — CID 133320956
(4-fluorophenyl)-(1-thieno[3,2-b]pyridin-7-ylpiperidin-4-yl)methanol (PubChem CID 133320956) has the molecular formula C19H19FN2OS and a molecular weight of 342.44 g/mol. Its IUPAC name is (4-fluorophenyl)-(1-thieno[3,2-b]pyridin-7-ylpiperidin-4-yl)methanol.
| Compound Name | (4-fluorophenyl)-(1-thieno[3,2-b]pyridin-7-ylpiperidin-4-yl)methanol |
|---|---|
| PubChem CID | 133320956 |
| Molecular Formula | C19H19FN2OS |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (4-fluorophenyl)-(1-thieno[3,2-b]pyridin-7-ylpiperidin-4-yl)methanol |
| SMILES | OC(c1ccc(F)cc1)C1CCN(c2ccnc3ccsc23)CC1 |
| InChI | InChI=1S/C19H19FN2OS/c20-15-3-1-13(2-4-15)18(23)14-6-10-22(11-7-14)17-5-9-21-16-8-12-24-19(16)17/h1-5,8-9,12,14,18,23H,6-7,10-11H2 |
| InChIKey | LHBRNUNVNQYSII-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |