C24H26ClN3O3 — CID 69176429
(2S)-3-[4-[2-[[3-[(4-chlorophenyl)methyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]ethoxy]phenyl]-2-cyanopropanoic acid (PubChem CID 69176429) has the molecular formula C24H26ClN3O3 and a molecular weight of 439.94 g/mol. Its IUPAC name is (2S)-3-[4-[2-[[3-[(4-chlorophenyl)methyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]ethoxy]phenyl]-2-cyanopropanoic acid.
| Compound Name | (2S)-3-[4-[2-[[3-[(4-chlorophenyl)methyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]ethoxy]phenyl]-2-cyanopropanoic acid |
|---|---|
| PubChem CID | 69176429 |
| Molecular Formula | C24H26ClN3O3 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | (2S)-3-[4-[2-[[3-[(4-chlorophenyl)methyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]ethoxy]phenyl]-2-cyanopropanoic acid |
| SMILES | N#C[C@H](Cc1ccc(OCCNC2C3CN(Cc4ccc(Cl)cc4)CC32)cc1)C(=O)O |
| InChI | InChI=1S/C24H26ClN3O3/c25-19-5-1-17(2-6-19)13-28-14-21-22(15-28)23(21)27-9-10-31-20-7-3-16(4-8-20)11-18(12-26)24(29)30/h1-8,18,21-23,27H,9-11,13-15H2,(H,29,30)/t18-,21?,22?,23?/m0/s1 |
| InChIKey | BTONJEQGWIEHFL-IHIONMKXSA-N |
| XLogP | 3.21 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|