C25H29F3N2O4 — CID 23658549
(2S)-2-ethoxy-3-[4-[2-[[(1S,5R)-3-[(2,4,5-trifluorophenyl)methyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]ethoxy]phenyl]propanoic acid (PubChem CID 23658549) has the molecular formula C25H29F3N2O4 and a molecular weight of 478.51 g/mol. Its IUPAC name is (2S)-2-ethoxy-3-[4-[2-[[(1S,5R)-3-[(2,4,5-trifluorophenyl)methyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]ethoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-ethoxy-3-[4-[2-[[(1S,5R)-3-[(2,4,5-trifluorophenyl)methyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 23658549 |
| Molecular Formula | C25H29F3N2O4 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | (2S)-2-ethoxy-3-[4-[2-[[(1S,5R)-3-[(2,4,5-trifluorophenyl)methyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]ethoxy]phenyl]propanoic acid |
| SMILES | CCO[C@@H](Cc1ccc(OCCNC2[C@H]3CN(Cc4cc(F)c(F)cc4F)C[C@@H]23)cc1)C(=O)O |
| InChI | InChI=1S/C25H29F3N2O4/c1-2-33-23(25(31)32)9-15-3-5-17(6-4-15)34-8-7-29-24-18-13-30(14-19(18)24)12-16-10-21(27)22(28)11-20(16)26/h3-6,10-11,18-19,23-24,29H,2,7-9,12-14H2,1H3,(H,31,32)/t18-,19+,23-,24?/m0/s1 |
| InChIKey | IVZLNFBINMPXFF-NFIHCRKGSA-N |
| XLogP | 3.23 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|