C33H36ClF3N2O5 — CID 69177259
(2S)-2-(4-tert-butylphenoxy)-3-[4-[2-[[(5R)-3-(2,4,5-trifluorobenzoyl)-3-azabicyclo[3.1.0]hexan-6-yl]amino]ethoxy]phenyl]propanoic acid;hydrochloride (PubChem CID 69177259) has the molecular formula C33H36ClF3N2O5 and a molecular weight of 633.11 g/mol. Its IUPAC name is (2S)-2-(4-tert-butylphenoxy)-3-[4-[2-[[(5R)-3-(2,4,5-trifluorobenzoyl)-3-azabicyclo[3.1.0]hexan-6-yl]amino]ethoxy]phenyl]propanoic acid;hydrochloride.
| Compound Name | (2S)-2-(4-tert-butylphenoxy)-3-[4-[2-[[(5R)-3-(2,4,5-trifluorobenzoyl)-3-azabicyclo[3.1.0]hexan-6-yl]amino]ethoxy]phenyl]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 69177259 |
| Molecular Formula | C33H36ClF3N2O5 |
| Molecular Weight | 633.11 g/mol |
| Exact Mass | 632.23 |
| IUPAC Name | (2S)-2-(4-tert-butylphenoxy)-3-[4-[2-[[(5R)-3-(2,4,5-trifluorobenzoyl)-3-azabicyclo[3.1.0]hexan-6-yl]amino]ethoxy]phenyl]propanoic acid;hydrochloride |
| SMILES | CC(C)(C)c1ccc(O[C@@H](Cc2ccc(OCCNC3C4CN(C(=O)c5cc(F)c(F)cc5F)C[C@@H]43)cc2)C(=O)O)cc1.Cl |
| InChI | InChI=1S/C33H35F3N2O5.ClH/c1-33(2,3)20-6-10-22(11-7-20)43-29(32(40)41)14-19-4-8-21(9-5-19)42-13-12-37-30-24-17-38(18-25(24)30)31(39)23-15-27(35)28(36)16-26(23)34;/h4-11,15-16,24-25,29-30,37H,12-14,17-18H2,1-3H3,(H,40,41);1H/t24-,25?,29-,30?;/m0./s1 |
| InChIKey | OSZXLDVOJBECDF-MCPLRELWSA-N |
| XLogP | 5.64 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.11 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|