C27H34F2N2O4 — CID 69177270
ethyl (2S)-3-[4-[2-[[3-[(2,4-difluorophenyl)methyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]ethoxy]phenyl]-2-ethoxypropanoate (PubChem CID 69177270) has the molecular formula C27H34F2N2O4 and a molecular weight of 488.58 g/mol. Its IUPAC name is ethyl (2S)-3-[4-[2-[[3-[(2,4-difluorophenyl)methyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]ethoxy]phenyl]-2-ethoxypropanoate.
| Compound Name | ethyl (2S)-3-[4-[2-[[3-[(2,4-difluorophenyl)methyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]ethoxy]phenyl]-2-ethoxypropanoate |
|---|---|
| PubChem CID | 69177270 |
| Molecular Formula | C27H34F2N2O4 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | ethyl (2S)-3-[4-[2-[[3-[(2,4-difluorophenyl)methyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]ethoxy]phenyl]-2-ethoxypropanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(OCCNC2C3CN(Cc4ccc(F)cc4F)CC32)cc1)OCC |
| InChI | InChI=1S/C27H34F2N2O4/c1-3-33-25(27(32)34-4-2)13-18-5-9-21(10-6-18)35-12-11-30-26-22-16-31(17-23(22)26)15-19-7-8-20(28)14-24(19)29/h5-10,14,22-23,25-26,30H,3-4,11-13,15-17H2,1-2H3/t22?,23?,25-,26?/m0/s1 |
| InChIKey | SLFNWPOYXWXBSZ-YPRXUAMTSA-N |
| XLogP | 3.57 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|