C31H31F5N2O4 — CID 69176082
ethyl (2S)-2-(3,5-difluorophenoxy)-3-[4-[2-[[(5R)-3-[(2,4,5-trifluorophenyl)methyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]ethoxy]phenyl]propanoate (PubChem CID 69176082) has the molecular formula C31H31F5N2O4 and a molecular weight of 590.59 g/mol. Its IUPAC name is ethyl (2S)-2-(3,5-difluorophenoxy)-3-[4-[2-[[(5R)-3-[(2,4,5-trifluorophenyl)methyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]ethoxy]phenyl]propanoate.
| Compound Name | ethyl (2S)-2-(3,5-difluorophenoxy)-3-[4-[2-[[(5R)-3-[(2,4,5-trifluorophenyl)methyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 69176082 |
| Molecular Formula | C31H31F5N2O4 |
| Molecular Weight | 590.59 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | ethyl (2S)-2-(3,5-difluorophenoxy)-3-[4-[2-[[(5R)-3-[(2,4,5-trifluorophenyl)methyl]-3-azabicyclo[3.1.0]hexan-6-yl]amino]ethoxy]phenyl]propanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(OCCNC2C3CN(Cc4cc(F)c(F)cc4F)C[C@@H]32)cc1)Oc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C31H31F5N2O4/c1-2-40-31(39)29(42-23-12-20(32)11-21(33)13-23)9-18-3-5-22(6-4-18)41-8-7-37-30-24-16-38(17-25(24)30)15-19-10-27(35)28(36)14-26(19)34/h3-6,10-14,24-25,29-30,37H,2,7-9,15-17H2,1H3/t24-,25?,29-,30?/m0/s1 |
| InChIKey | KQMUORSZSJTOIN-AIOYLYKNSA-N |
| XLogP | 5.03 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.59 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|