C30H42O4 — CID 69177467
(1S,2R,4aS,6aR,6aS,6bR,8aR,12aR,14bS)-1,2,6a,6b,9,9,12a-heptamethyl-8,10-dioxo-2,3,4,5,6,6a,7,8a,13,14b-decahydro-1H-picene-4a-carboxylic acid (PubChem CID 69177467) has the molecular formula C30H42O4 and a molecular weight of 466.66 g/mol. Its IUPAC name is (1S,2R,4aS,6aR,6aS,6bR,8aR,12aR,14bS)-1,2,6a,6b,9,9,12a-heptamethyl-8,10-dioxo-2,3,4,5,6,6a,7,8a,13,14b-decahydro-1H-picene-4a-carboxylic acid.
| Compound Name | (1S,2R,4aS,6aR,6aS,6bR,8aR,12aR,14bS)-1,2,6a,6b,9,9,12a-heptamethyl-8,10-dioxo-2,3,4,5,6,6a,7,8a,13,14b-decahydro-1H-picene-4a-carboxylic acid |
|---|---|
| PubChem CID | 69177467 |
| Molecular Formula | C30H42O4 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | (1S,2R,4aS,6aR,6aS,6bR,8aR,12aR,14bS)-1,2,6a,6b,9,9,12a-heptamethyl-8,10-dioxo-2,3,4,5,6,6a,7,8a,13,14b-decahydro-1H-picene-4a-carboxylic acid |
| SMILES | C[C@H]1[C@H](C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)C=CC(=O)C(C)(C)[C@@H]5C(=O)C[C@]43C)[C@H]12 |
| InChI | InChI=1S/C30H42O4/c1-17-10-13-30(25(33)34)15-14-28(6)19(23(30)18(17)2)8-9-21-27(5)12-11-22(32)26(3,4)24(27)20(31)16-29(21,28)7/h8,11-12,17-18,21,23-24H,9-10,13-16H2,1-7H3,(H,33,34)/t17-,18+,21-,23+,24+,27-,28-,29-,30+/m1/s1 |
| InChIKey | QSVIBJOEXISIMF-QAMQDBAXSA-N |
| XLogP | 6.25 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|