C16H16N2O2 — CID 69177687
(4E)-5-methyl-4-[(2-methyl-2,3-dihydrofuran-5-yl)methylidene]-2-phenylpyrazol-3-one (PubChem CID 69177687) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is (4E)-5-methyl-4-[(2-methyl-2,3-dihydrofuran-5-yl)methylidene]-2-phenylpyrazol-3-one.
| Compound Name | (4E)-5-methyl-4-[(2-methyl-2,3-dihydrofuran-5-yl)methylidene]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 69177687 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (4E)-5-methyl-4-[(2-methyl-2,3-dihydrofuran-5-yl)methylidene]-2-phenylpyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)/C1=C/C1=CCC(C)O1 |
| InChI | InChI=1S/C16H16N2O2/c1-11-8-9-14(20-11)10-15-12(2)17-18(16(15)19)13-6-4-3-5-7-13/h3-7,9-11H,8H2,1-2H3/b15-10+ |
| InChIKey | WKQXDPNIBLWNHF-XNTDXEJSSA-N |
| XLogP | 3.03 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|