C46H28Cl2N8S2 — CID 69177690
2,3-bis[3-chloro-4-(2-methyl-8-thiophen-2-ylimidazo[4,5-c]quinolin-1-yl)phenyl]butanedinitrile (PubChem CID 69177690) has the molecular formula C46H28Cl2N8S2 and a molecular weight of 827.83 g/mol. Its IUPAC name is 2,3-bis[3-chloro-4-(2-methyl-8-thiophen-2-ylimidazo[4,5-c]quinolin-1-yl)phenyl]butanedinitrile.
| Compound Name | 2,3-bis[3-chloro-4-(2-methyl-8-thiophen-2-ylimidazo[4,5-c]quinolin-1-yl)phenyl]butanedinitrile |
|---|---|
| PubChem CID | 69177690 |
| Molecular Formula | C46H28Cl2N8S2 |
| Molecular Weight | 827.83 g/mol |
| Exact Mass | 826.13 |
| IUPAC Name | 2,3-bis[3-chloro-4-(2-methyl-8-thiophen-2-ylimidazo[4,5-c]quinolin-1-yl)phenyl]butanedinitrile |
| SMILES | Cc1nc2cnc3ccc(-c4cccs4)cc3c2n1-c1ccc(C(C#N)C(C#N)c2ccc(-n3c(C)nc4cnc5ccc(-c6cccs6)cc5c43)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C46H28Cl2N8S2/c1-25-53-39-23-51-37-11-7-29(43-5-3-15-57-43)17-31(37)45(39)55(25)41-13-9-27(19-35(41)47)33(21-49)34(22-50)28-10-14-42(36(48)20-28)56-26(2)54-40-24-52-38-12-8-30(18-32(38)46(40)56)44-6-4-16-58-44/h3-20,23-24,33-34H,1-2H3 |
| InChIKey | IMWWKAZDEMIWRH-UHFFFAOYSA-N |
| XLogP | 12.76 |
| TPSA | 109.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.83 |
| LogP ≤ 5 | 12.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |