C34H35N5O4 — CID 69178441
tert-butyl 2-[[[(Z)-4-(1,3-dioxoisoindol-2-yl)but-2-enyl]-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]benzimidazole-1-carboxylate (PubChem CID 69178441) has the molecular formula C34H35N5O4 and a molecular weight of 577.69 g/mol. Its IUPAC name is tert-butyl 2-[[[(Z)-4-(1,3-dioxoisoindol-2-yl)but-2-enyl]-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]benzimidazole-1-carboxylate.
| Compound Name | tert-butyl 2-[[[(Z)-4-(1,3-dioxoisoindol-2-yl)but-2-enyl]-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]benzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 69178441 |
| Molecular Formula | C34H35N5O4 |
| Molecular Weight | 577.69 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | tert-butyl 2-[[[(Z)-4-(1,3-dioxoisoindol-2-yl)but-2-enyl]-(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]benzimidazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1c(CN(C/C=C\CN2C(=O)c3ccccc3C2=O)C2CCCc3cccnc32)nc2ccccc21 |
| InChI | InChI=1S/C34H35N5O4/c1-34(2,3)43-33(42)39-27-17-7-6-16-26(27)36-29(39)22-37(28-18-10-12-23-13-11-19-35-30(23)28)20-8-9-21-38-31(40)24-14-4-5-15-25(24)32(38)41/h4-9,11,13-17,19,28H,10,12,18,20-22H2,1-3H3/b9-8- |
| InChIKey | FGEBXJUZALBEIE-HJWRWDBZSA-N |
| XLogP | 5.95 |
| TPSA | 97.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.69 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|