C26H42B2N5O2 — CID 91322180
CID 91322180 (PubChem CID 91322180) has the molecular formula C26H42B2N5O2 and a molecular weight of 478.28 g/mol.
| Compound Name | CID 91322180 |
|---|---|
| PubChem CID | 91322180 |
| Molecular Formula | C26H42B2N5O2 |
| Molecular Weight | 478.28 g/mol |
| Exact Mass | 478.35 |
| IUPAC Name | — |
| SMILES | CC.CC.C[B]On1c(CN(CCN(C)B(C)O)C2CCCc3cccnc32)nc2ccccc21 |
| InChI | InChI=1S/C22H30B2N5O2.2C2H6/c1-23-31-29-19-11-5-4-10-18(19)26-21(29)16-28(15-14-27(3)24(2)30)20-12-6-8-17-9-7-13-25-22(17)20;2*1-2/h4-5,7,9-11,13,20,30H,6,8,12,14-16H2,1-3H3;2*1-2H3 |
| InChIKey | BWISNOQHDZWFRP-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 66.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.28 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|