C17H25F2N3O2 — CID 69182304
(4,4-difluoro-3-methylbut-3-enyl) 4-methyl-2-[methyl(pentyl)amino]pyrimidine-5-carboxylate (PubChem CID 69182304) has the molecular formula C17H25F2N3O2 and a molecular weight of 341.40 g/mol. Its IUPAC name is (4,4-difluoro-3-methylbut-3-enyl) 4-methyl-2-[methyl(pentyl)amino]pyrimidine-5-carboxylate.
| Compound Name | (4,4-difluoro-3-methylbut-3-enyl) 4-methyl-2-[methyl(pentyl)amino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 69182304 |
| Molecular Formula | C17H25F2N3O2 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | (4,4-difluoro-3-methylbut-3-enyl) 4-methyl-2-[methyl(pentyl)amino]pyrimidine-5-carboxylate |
| SMILES | CCCCCN(C)c1ncc(C(=O)OCCC(C)=C(F)F)c(C)n1 |
| InChI | InChI=1S/C17H25F2N3O2/c1-5-6-7-9-22(4)17-20-11-14(13(3)21-17)16(23)24-10-8-12(2)15(18)19/h11H,5-10H2,1-4H3 |
| InChIKey | LUJOLPPBNFQNOW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|