C10H25Cl2MnN5 — CID 6918270
dichloromanganese;1,4,7,10,13-pentazacyclopentadecane (PubChem CID 6918270) has the molecular formula C10H25Cl2MnN5 and a molecular weight of 341.19 g/mol. Its IUPAC name is dichloromanganese;1,4,7,10,13-pentazacyclopentadecane.
| Compound Name | dichloromanganese;1,4,7,10,13-pentazacyclopentadecane |
|---|---|
| PubChem CID | 6918270 |
| Molecular Formula | C10H25Cl2MnN5 |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | dichloromanganese;1,4,7,10,13-pentazacyclopentadecane |
| SMILES | C1CNCCNCCNCCNCCN1.Cl[Mn]Cl |
| InChI | InChI=1S/C10H25N5.2ClH.Mn/c1-2-12-5-6-14-9-10-15-8-7-13-4-3-11-1;;;/h11-15H,1-10H2;2*1H;/q;;;+2/p-2 |
| InChIKey | OUFRIFBWDYXPAQ-UHFFFAOYSA-L |
| XLogP | -0.68 |
| TPSA | 60.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |