C17H17F3N4O4S — CID 69183481
2-[[benzoyl-[[6-(trifluoromethyl)-3-pyridinyl]methyl]amino]-methylsulfonylamino]acetamide (PubChem CID 69183481) has the molecular formula C17H17F3N4O4S and a molecular weight of 430.41 g/mol. Its IUPAC name is 2-[[benzoyl-[[6-(trifluoromethyl)-3-pyridinyl]methyl]amino]-methylsulfonylamino]acetamide.
| Compound Name | 2-[[benzoyl-[[6-(trifluoromethyl)-3-pyridinyl]methyl]amino]-methylsulfonylamino]acetamide |
|---|---|
| PubChem CID | 69183481 |
| Molecular Formula | C17H17F3N4O4S |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 2-[[benzoyl-[[6-(trifluoromethyl)-3-pyridinyl]methyl]amino]-methylsulfonylamino]acetamide |
| SMILES | CS(=O)(=O)N(CC(N)=O)N(Cc1ccc(C(F)(F)F)nc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H17F3N4O4S/c1-29(27,28)24(11-15(21)25)23(16(26)13-5-3-2-4-6-13)10-12-7-8-14(22-9-12)17(18,19)20/h2-9H,10-11H2,1H3,(H2,21,25) |
| InChIKey | RGXHKTWPKYFKSL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 113.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|