C25H27N3O3 — CID 69183915
2-cyclohexyl-4-(4-nitrophenoxy)-6-(3-phenylpropyl)pyrimidine (PubChem CID 69183915) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-cyclohexyl-4-(4-nitrophenoxy)-6-(3-phenylpropyl)pyrimidine.
| Compound Name | 2-cyclohexyl-4-(4-nitrophenoxy)-6-(3-phenylpropyl)pyrimidine |
|---|---|
| PubChem CID | 69183915 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 2-cyclohexyl-4-(4-nitrophenoxy)-6-(3-phenylpropyl)pyrimidine |
| SMILES | O=[N+]([O-])c1ccc(Oc2cc(CCCc3ccccc3)nc(C3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C25H27N3O3/c29-28(30)22-14-16-23(17-15-22)31-24-18-21(13-7-10-19-8-3-1-4-9-19)26-25(27-24)20-11-5-2-6-12-20/h1,3-4,8-9,14-18,20H,2,5-7,10-13H2 |
| InChIKey | NBJYIVMJXOCIHA-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|