C19H29NO4 — CID 69183987
2-methylpropyl N-[(2S)-1-[4-(1-ethoxyethenyl)phenyl]-4-hydroxybutan-2-yl]carbamate (PubChem CID 69183987) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is 2-methylpropyl N-[(2S)-1-[4-(1-ethoxyethenyl)phenyl]-4-hydroxybutan-2-yl]carbamate.
| Compound Name | 2-methylpropyl N-[(2S)-1-[4-(1-ethoxyethenyl)phenyl]-4-hydroxybutan-2-yl]carbamate |
|---|---|
| PubChem CID | 69183987 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 2-methylpropyl N-[(2S)-1-[4-(1-ethoxyethenyl)phenyl]-4-hydroxybutan-2-yl]carbamate |
| SMILES | C=C(OCC)c1ccc(C[C@@H](CCO)NC(=O)OCC(C)C)cc1 |
| InChI | InChI=1S/C19H29NO4/c1-5-23-15(4)17-8-6-16(7-9-17)12-18(10-11-21)20-19(22)24-13-14(2)3/h6-9,14,18,21H,4-5,10-13H2,1-3H3,(H,20,22)/t18-/m1/s1 |
| InChIKey | IVVGJUFKZQKOHV-GOSISDBHSA-N |
| XLogP | 3.37 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|