C12H16ClN3O2 — CID 6918524
7-(4-methylpiperazin-1-yl)-3H-1,3-benzoxazol-2-one;hydrochloride (PubChem CID 6918524) has the molecular formula C12H16ClN3O2 and a molecular weight of 269.73 g/mol. Its IUPAC name is 7-(4-methylpiperazin-1-yl)-3H-1,3-benzoxazol-2-one;hydrochloride.
| Compound Name | 7-(4-methylpiperazin-1-yl)-3H-1,3-benzoxazol-2-one;hydrochloride |
|---|---|
| PubChem CID | 6918524 |
| Molecular Formula | C12H16ClN3O2 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 7-(4-methylpiperazin-1-yl)-3H-1,3-benzoxazol-2-one;hydrochloride |
| SMILES | CN1CCN(c2cccc3[nH]c(=O)oc23)CC1.Cl |
| InChI | InChI=1S/C12H15N3O2.ClH/c1-14-5-7-15(8-6-14)10-4-2-3-9-11(10)17-12(16)13-9;/h2-4H,5-8H2,1H3,(H,13,16);1H |
| InChIKey | NQRIKTDKFHAOKC-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 52.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |