C21H25NO4S — CID 69187671
[2-[(2-tert-butylphenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl] acetate (PubChem CID 69187671) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is [2-[(2-tert-butylphenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl] acetate.
| Compound Name | [2-[(2-tert-butylphenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl] acetate |
|---|---|
| PubChem CID | 69187671 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | [2-[(2-tert-butylphenyl)sulfonylamino]-2,3-dihydro-1H-inden-5-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)CC(NS(=O)(=O)c1ccccc1C(C)(C)C)C2 |
| InChI | InChI=1S/C21H25NO4S/c1-14(23)26-18-10-9-15-11-17(12-16(15)13-18)22-27(24,25)20-8-6-5-7-19(20)21(2,3)4/h5-10,13,17,22H,11-12H2,1-4H3 |
| InChIKey | JAKBLYWCMVAHTM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|