C22H21NO6S3 — CID 67678013
[2-[[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]methyl]-2,3-dihydro-1H-inden-5-yl] acetate (PubChem CID 67678013) has the molecular formula C22H21NO6S3 and a molecular weight of 491.61 g/mol. Its IUPAC name is [2-[[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]methyl]-2,3-dihydro-1H-inden-5-yl] acetate.
| Compound Name | [2-[[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]methyl]-2,3-dihydro-1H-inden-5-yl] acetate |
|---|---|
| PubChem CID | 67678013 |
| Molecular Formula | C22H21NO6S3 |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | [2-[[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]methyl]-2,3-dihydro-1H-inden-5-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)CC(CNS(=O)(=O)c1ccc(S(=O)(=O)c3ccccc3)s1)C2 |
| InChI | InChI=1S/C22H21NO6S3/c1-15(24)29-19-8-7-17-11-16(12-18(17)13-19)14-23-32(27,28)22-10-9-21(30-22)31(25,26)20-5-3-2-4-6-20/h2-10,13,16,23H,11-12,14H2,1H3 |
| InChIKey | MOIUSAOYBFBQDN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|