About [2-[[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]methyl]-2,3-dihydro-1H-inden-5-yl] acetate
[2-[[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]methyl]-2,3-dihydro-1H-inden-5-yl] acetate (PubChem CID 67678013) has the molecular formula C22H21NO6S3
and a molecular weight of 491.61 g/mol. Its IUPAC name is [2-[[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]methyl]-2,3-dihydro-1H-inden-5-yl] acetate.
Molecular Properties
| Compound Name | [2-[[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]methyl]-2,3-dihydro-1H-inden-5-yl] acetate |
| PubChem CID | 67678013 |
| Molecular Formula | C22H21NO6S3 |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | [2-[[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]methyl]-2,3-dihydro-1H-inden-5-yl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)CC(CNS(=O)(=O)c1ccc(S(=O)(=O)c3ccccc3)s1)C2 |
| InChI | InChI=1S/C22H21NO6S3/c1-15(24)29-19-8-7-17-11-16(12-18(17)13-19)14-23-32(27,28)22-10-9-21(30-22)31(25,26)20-5-3-2-4-6-20/h2-10,13,16,23H,11-12,14H2,1H3 |
| InChIKey | MOIUSAOYBFBQDN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]methyl]-2,3-dihydro-1H-inden-5-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]methyl]-2,3-dihydro-1H-inden-5-yl] acetate?
The IUPAC name of [2-[[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]methyl]-2,3-dihydro-1H-inden-5-yl] acetate (CID 67678013) is [2-[[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]methyl]-2,3-dihydro-1H-inden-5-yl] acetate.
What is the SMILES notation for [2-[[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]methyl]-2,3-dihydro-1H-inden-5-yl] acetate?
The canonical SMILES for [2-[[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]methyl]-2,3-dihydro-1H-inden-5-yl] acetate is CC(=O)Oc1ccc2c(c1)CC(CNS(=O)(=O)c1ccc(S(=O)(=O)c3ccccc3)s1)C2.
What is the InChIKey of [2-[[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]methyl]-2,3-dihydro-1H-inden-5-yl] acetate?
The InChIKey is MOIUSAOYBFBQDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO6S3/c1-15(24)29-19-8-7-17-11-16(12-18(17)13-19)14-23-32(27,28)22-10-9-21(30-22)31(25,26)20-5-3-2-4-6-20/h2-10,13,16,23H,11-12,14H2,1H3.
What are the key properties of [2-[[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]methyl]-2,3-dihydro-1H-inden-5-yl] acetate?
[2-[[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]methyl]-2,3-dihydro-1H-inden-5-yl] acetate has a molecular weight of 491.61 g/mol, XLogP of 3.20, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]methyl]-2,3-dihydro-1H-inden-5-yl] acetate is sourced from PubChem (CID 67678013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).